C12H11KO3S — CID 101323807
potassium 6,7-dimethylnaphthalene-2-sulfonate (PubChem CID 101323807) has the molecular formula C12H11KO3S and a molecular weight of 274.38 g/mol. Its IUPAC name is potassium 6,7-dimethylnaphthalene-2-sulfonate.
| Compound Name | potassium 6,7-dimethylnaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 101323807 |
| Molecular Formula | C12H11KO3S |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | potassium 6,7-dimethylnaphthalene-2-sulfonate |
| SMILES | Cc1cc2ccc(S(=O)(=O)[O-])cc2cc1C.[K+] |
| InChI | InChI=1S/C12H12O3S.K/c1-8-5-10-3-4-12(16(13,14)15)7-11(10)6-9(8)2;/h3-7H,1-2H3,(H,13,14,15);/q;+1/p-1 |
| InChIKey | PDWFMWICOALJMH-UHFFFAOYSA-M |
| XLogP | -0.64 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|