C16H10N2NaO7S2- — CID 169408459
sodium 7-hydroxy-8-phenyldiazenylnaphthalene-1,3-disulfonate (PubChem CID 169408459) has the molecular formula C16H10N2NaO7S2- and a molecular weight of 429.39 g/mol. Its IUPAC name is sodium 7-hydroxy-8-phenyldiazenylnaphthalene-1,3-disulfonate.
| Compound Name | sodium 7-hydroxy-8-phenyldiazenylnaphthalene-1,3-disulfonate |
|---|---|
| PubChem CID | 169408459 |
| Molecular Formula | C16H10N2NaO7S2- |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 428.98 |
| IUPAC Name | sodium 7-hydroxy-8-phenyldiazenylnaphthalene-1,3-disulfonate |
| SMILES | O=S(=O)([O-])c1cc(S(=O)(=O)[O-])c2c(/N=N/c3ccccc3)c(O)ccc2c1.[Na+] |
| InChI | InChI=1S/C16H12N2O7S2.Na/c19-13-7-6-10-8-12(26(20,21)22)9-14(27(23,24)25)15(10)16(13)18-17-11-4-2-1-3-5-11;/h1-9,19H,(H,20,21,22)(H,23,24,25);/q;+1/p-2/b18-17+; |
| InChIKey | CIGSMIXKOZNUKZ-ZAGWXBKKSA-L |
| XLogP | -0.23 |
| TPSA | 159.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|