C17H14N2Na2O7S2 — CID 137235002
CID 137235002 (PubChem CID 137235002) has the molecular formula C17H14N2Na2O7S2 and a molecular weight of 468.42 g/mol.
| Compound Name | CID 137235002 |
|---|---|
| PubChem CID | 137235002 |
| Molecular Formula | C17H14N2Na2O7S2 |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 468.00 |
| IUPAC Name | — |
| SMILES | Cc1ccc(/N=N/c2c(O)ccc3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c23)cc1.[Na].[Na] |
| InChI | InChI=1S/C17H14N2O7S2.2Na/c1-10-2-5-12(6-3-10)18-19-17-14(20)7-4-11-8-13(27(21,22)23)9-15(16(11)17)28(24,25)26;;/h2-9,20H,1H3,(H,21,22,23)(H,24,25,26);;/b19-18+;; |
| InChIKey | XPQZTKMEMUKLAL-BUFQOAPZSA-N |
| XLogP | 3.00 |
| TPSA | 153.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|