C35H32N4Na2O8S2 — CID 137228306
disodium 8-{[4-(cyclohexyl{4-[(4-hydroxyphenyl)diazenyl]phenyl}methyl)phenyl]diazenyl}-7-hydroxy-1,3-naphthalenedisulfonate (PubChem CID 137228306) has the molecular formula C35H32N4Na2O8S2 and a molecular weight of 746.78 g/mol.
| Compound Name | disodium 8-{[4-(cyclohexyl{4-[(4-hydroxyphenyl)diazenyl]phenyl}methyl)phenyl]diazenyl}-7-hydroxy-1,3-naphthalenedisulfonate |
|---|---|
| PubChem CID | 137228306 |
| Molecular Formula | C35H32N4Na2O8S2 |
| Molecular Weight | 746.78 g/mol |
| Exact Mass | 746.15 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1cc(S(=O)(=O)O)c2c(/N=N/c3ccc(C(c4ccc(/N=N/c5ccc(O)cc5)cc4)C4CCCCC4)cc3)c(O)ccc2c1.[Na].[Na] |
| InChI | InChI=1S/C35H32N4O8S2.2Na/c40-29-17-15-28(16-18-29)37-36-26-11-6-23(7-12-26)33(22-4-2-1-3-5-22)24-8-13-27(14-9-24)38-39-35-31(41)19-10-25-20-30(48(42,43)44)21-32(34(25)35)49(45,46)47;;/h6-22,33,40-41H,1-5H2,(H,42,43,44)(H,45,46,47);;/b37-36+,39-38+;; |
| InChIKey | MTYRSGKDGBZRRD-FBBBJYKDSA-N |
| XLogP | 8.53 |
| TPSA | 198.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.78 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|