C22H16N4O10S3-2 — CID 161131700
7-hydroxy-3-sulfo-8-[[4-[(4-sulfonatophenyl)diazenyl]phenyl]diazenyl]naphthalene-1-sulfonate;molecular hydrogen (PubChem CID 161131700) has the molecular formula C22H16N4O10S3-2 and a molecular weight of 592.59 g/mol. Its IUPAC name is 7-hydroxy-3-sulfo-8-[[4-[(4-sulfonatophenyl)diazenyl]phenyl]diazenyl]naphthalene-1-sulfonate;molecular hydrogen.
| Compound Name | 7-hydroxy-3-sulfo-8-[[4-[(4-sulfonatophenyl)diazenyl]phenyl]diazenyl]naphthalene-1-sulfonate;molecular hydrogen |
|---|---|
| PubChem CID | 161131700 |
| Molecular Formula | C22H16N4O10S3-2 |
| Molecular Weight | 592.59 g/mol |
| Exact Mass | 592.00 |
| IUPAC Name | 7-hydroxy-3-sulfo-8-[[4-[(4-sulfonatophenyl)diazenyl]phenyl]diazenyl]naphthalene-1-sulfonate;molecular hydrogen |
| SMILES | O=S(=O)([O-])c1ccc(/N=N/c2ccc(/N=N/c3c(O)ccc4cc(S(=O)(=O)O)cc(S(=O)(=O)[O-])c34)cc2)cc1.[H][H] |
| InChI | InChI=1S/C22H16N4O10S3.H2/c27-19-10-1-13-11-18(38(31,32)33)12-20(39(34,35)36)21(13)22(19)26-25-15-4-2-14(3-5-15)23-24-16-6-8-17(9-7-16)37(28,29)30;/h1-12,27H,(H,28,29,30)(H,31,32,33)(H,34,35,36);1H/p-2/b24-23+,26-25+; |
| InChIKey | UMGUMJFOSXPTFO-HMNSNYPBSA-L |
| XLogP | 4.68 |
| TPSA | 238.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.59 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|