C24H19N4NaO7S2 — CID 156676683
sodium 7-hydroxy-8-[[2-methyl-4-[(2-methyl-4-sulfophenyl)diazenyl]phenyl]diazenyl]naphthalene-1-sulfonate (PubChem CID 156676683) has the molecular formula C24H19N4NaO7S2 and a molecular weight of 562.56 g/mol. Its IUPAC name is sodium 7-hydroxy-8-[[2-methyl-4-[(2-methyl-4-sulfophenyl)diazenyl]phenyl]diazenyl]naphthalene-1-sulfonate.
| Compound Name | sodium 7-hydroxy-8-[[2-methyl-4-[(2-methyl-4-sulfophenyl)diazenyl]phenyl]diazenyl]naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 156676683 |
| Molecular Formula | C24H19N4NaO7S2 |
| Molecular Weight | 562.56 g/mol |
| Exact Mass | 562.06 |
| IUPAC Name | sodium 7-hydroxy-8-[[2-methyl-4-[(2-methyl-4-sulfophenyl)diazenyl]phenyl]diazenyl]naphthalene-1-sulfonate |
| SMILES | Cc1cc(S(=O)(=O)O)ccc1/N=N/c1ccc(/N=N/c2c(O)ccc3cccc(S(=O)(=O)[O-])c23)c(C)c1.[Na+] |
| InChI | InChI=1S/C24H20N4O7S2.Na/c1-14-12-17(25-26-20-10-8-18(13-15(20)2)36(30,31)32)7-9-19(14)27-28-24-21(29)11-6-16-4-3-5-22(23(16)24)37(33,34)35;/h3-13,29H,1-2H3,(H,30,31,32)(H,33,34,35);/q;+1/p-1/b26-25+,28-27+; |
| InChIKey | NFMCHIASHYBNPO-UFVBRFPFSA-M |
| XLogP | 3.15 |
| TPSA | 181.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.56 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|