C32H23N5Na2O7S2+2 — CID 139595340
disodium;4-amino-3-[[4-[4-[(2-hydroxy-8-sulfonaphthalen-1-yl)diazenyl]phenyl]phenyl]diazenyl]naphthalene-1-sulfonic acid (PubChem CID 139595340) has the molecular formula C32H23N5Na2O7S2+2 and a molecular weight of 699.68 g/mol. Its IUPAC name is disodium;4-amino-3-[[4-[4-[(2-hydroxy-8-sulfonaphthalen-1-yl)diazenyl]phenyl]phenyl]diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | disodium;4-amino-3-[[4-[4-[(2-hydroxy-8-sulfonaphthalen-1-yl)diazenyl]phenyl]phenyl]diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 139595340 |
| Molecular Formula | C32H23N5Na2O7S2+2 |
| Molecular Weight | 699.68 g/mol |
| Exact Mass | 699.08 |
| IUPAC Name | disodium;4-amino-3-[[4-[4-[(2-hydroxy-8-sulfonaphthalen-1-yl)diazenyl]phenyl]phenyl]diazenyl]naphthalene-1-sulfonic acid |
| SMILES | Nc1c(/N=N/c2ccc(-c3ccc(/N=N/c4c(O)ccc5cccc(S(=O)(=O)O)c45)cc3)cc2)cc(S(=O)(=O)O)c2ccccc12.[Na+].[Na+] |
| InChI | InChI=1S/C32H23N5O7S2.2Na/c33-31-25-6-2-1-5-24(25)29(46(42,43)44)18-26(31)36-34-22-13-8-19(9-14-22)20-10-15-23(16-11-20)35-37-32-27(38)17-12-21-4-3-7-28(30(21)32)45(39,40)41;;/h1-18,38H,33H2,(H,39,40,41)(H,42,43,44);;/q;2*+1/b36-34+,37-35+;; |
| InChIKey | XXDRHTUBHMZGEB-AVRYKWKFSA-N |
| XLogP | 2.28 |
| TPSA | 204.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.68 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|