C32H21N5Na2O8S2 — CID 165363023
disodium;6-amino-4-hydroxy-5-[[4-[4-[(1-hydroxy-4-sulfonatonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]naphthalene-2-sulfonate (PubChem CID 165363023) has the molecular formula C32H21N5Na2O8S2 and a molecular weight of 713.66 g/mol. Its IUPAC name is disodium;6-amino-4-hydroxy-5-[[4-[4-[(1-hydroxy-4-sulfonatonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]naphthalene-2-sulfonate.
| Compound Name | disodium;6-amino-4-hydroxy-5-[[4-[4-[(1-hydroxy-4-sulfonatonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 165363023 |
| Molecular Formula | C32H21N5Na2O8S2 |
| Molecular Weight | 713.66 g/mol |
| Exact Mass | 713.06 |
| IUPAC Name | disodium;6-amino-4-hydroxy-5-[[4-[4-[(1-hydroxy-4-sulfonatonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]naphthalene-2-sulfonate |
| SMILES | Nc1ccc2cc(S(=O)(=O)[O-])cc(O)c2c1/N=N/c1ccc(-c2ccc(/N=N/c3cc(S(=O)(=O)[O-])c4ccccc4c3O)cc2)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C32H23N5O8S2.2Na/c33-26-14-9-20-15-23(46(40,41)42)16-28(38)30(20)31(26)37-35-22-12-7-19(8-13-22)18-5-10-21(11-6-18)34-36-27-17-29(47(43,44)45)24-3-1-2-4-25(24)32(27)39;;/h1-17,38-39H,33H2,(H,40,41,42)(H,43,44,45);;/q;2*+1/p-2/b36-34+,37-35+;; |
| InChIKey | CWPKLWJBVHWDKG-AVRYKWKFSA-L |
| XLogP | 1.30 |
| TPSA | 230.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.66 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|