C22H15N5O7S2-2 — CID 135831324
6-amino-4-hydroxy-3-[[4-[(4-sulfonatophenyl)diazenyl]phenyl]diazenyl]naphthalene-1-sulfonate (PubChem CID 135831324) has the molecular formula C22H15N5O7S2-2 and a molecular weight of 525.52 g/mol. Its IUPAC name is 6-amino-4-hydroxy-3-[[4-[(4-sulfonatophenyl)diazenyl]phenyl]diazenyl]naphthalene-1-sulfonate.
| Compound Name | 6-amino-4-hydroxy-3-[[4-[(4-sulfonatophenyl)diazenyl]phenyl]diazenyl]naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 135831324 |
| Molecular Formula | C22H15N5O7S2-2 |
| Molecular Weight | 525.52 g/mol |
| Exact Mass | 525.04 |
| IUPAC Name | 6-amino-4-hydroxy-3-[[4-[(4-sulfonatophenyl)diazenyl]phenyl]diazenyl]naphthalene-1-sulfonate |
| SMILES | Nc1ccc2c(S(=O)(=O)[O-])cc(/N=N/c3ccc(/N=N/c4ccc(S(=O)(=O)[O-])cc4)cc3)c(O)c2c1 |
| InChI | InChI=1S/C22H17N5O7S2/c23-13-1-10-18-19(11-13)22(28)20(12-21(18)36(32,33)34)27-26-15-4-2-14(3-5-15)24-25-16-6-8-17(9-7-16)35(29,30)31/h1-12,28H,23H2,(H,29,30,31)(H,32,33,34)/p-2/b25-24+,27-26+ |
| InChIKey | IYDMTTVTKOJURO-JQRDNDPDSA-L |
| XLogP | 4.77 |
| TPSA | 210.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|