C16H14N4O — CID 175748913
7-amino-2-[(4-aminophenyl)diazenyl]naphthalen-1-ol (PubChem CID 175748913) has the molecular formula C16H14N4O and a molecular weight of 278.31 g/mol. Its IUPAC name is 7-amino-2-[(4-aminophenyl)diazenyl]naphthalen-1-ol.
| Compound Name | 7-amino-2-[(4-aminophenyl)diazenyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 175748913 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 7-amino-2-[(4-aminophenyl)diazenyl]naphthalen-1-ol |
| SMILES | Nc1ccc(/N=N/c2ccc3ccc(N)cc3c2O)cc1 |
| InChI | InChI=1S/C16H14N4O/c17-11-4-6-13(7-5-11)19-20-15-8-2-10-1-3-12(18)9-14(10)16(15)21/h1-9,21H,17-18H2/b20-19+ |
| InChIKey | VVLWAGOTFYAEJS-FMQUCBEESA-N |
| XLogP | 4.13 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|