C19H20N5O3+ — CID 135858844
[7-[(4-amino-2-nitrophenyl)diazenyl]-8-hydroxynaphthalen-2-yl]-trimethylazanium (PubChem CID 135858844) has the molecular formula C19H20N5O3+ and a molecular weight of 366.40 g/mol. Its IUPAC name is [7-[(4-amino-2-nitrophenyl)diazenyl]-8-hydroxynaphthalen-2-yl]-trimethylazanium.
| Compound Name | [7-[(4-amino-2-nitrophenyl)diazenyl]-8-hydroxynaphthalen-2-yl]-trimethylazanium |
|---|---|
| PubChem CID | 135858844 |
| Molecular Formula | C19H20N5O3+ |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | [7-[(4-amino-2-nitrophenyl)diazenyl]-8-hydroxynaphthalen-2-yl]-trimethylazanium |
| SMILES | C[N+](C)(C)c1ccc2ccc(/N=N/c3ccc(N)cc3[N+](=O)[O-])c(O)c2c1 |
| InChI | InChI=1S/C19H19N5O3/c1-24(2,3)14-7-4-12-5-8-17(19(25)15(12)11-14)22-21-16-9-6-13(20)10-18(16)23(26)27/h4-11H,1-3H3,(H2-,20,21,22,25)/p+1 |
| InChIKey | NUYAOZDSBBHXIN-UHFFFAOYSA-O |
| XLogP | 4.65 |
| TPSA | 114.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|