C20H20ClN5O3 — CID 159210476
[8-[(4-amino-2-nitrophenyl)diazenyl]-7-hydroxynaphthalen-2-yl]-(2-chloroethyl)-methylideneazanium;methane (PubChem CID 159210476) has the molecular formula C20H20ClN5O3 and a molecular weight of 413.87 g/mol. Its IUPAC name is [8-[(4-amino-2-nitrophenyl)diazenyl]-7-hydroxynaphthalen-2-yl]-(2-chloroethyl)-methylideneazanium;methane.
| Compound Name | [8-[(4-amino-2-nitrophenyl)diazenyl]-7-hydroxynaphthalen-2-yl]-(2-chloroethyl)-methylideneazanium;methane |
|---|---|
| PubChem CID | 159210476 |
| Molecular Formula | C20H20ClN5O3 |
| Molecular Weight | 413.87 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | [8-[(4-amino-2-nitrophenyl)diazenyl]-7-hydroxynaphthalen-2-yl]-(2-chloroethyl)-methylideneazanium;methane |
| SMILES | C.C=[N+](C[CH-]Cl)c1ccc2ccc(O)c(/N=N/c3ccc(N)cc3[N+](=O)[O-])c2c1 |
| InChI | InChI=1S/C19H16ClN5O3.CH4/c1-24(9-8-20)14-5-2-12-3-7-18(26)19(15(12)11-14)23-22-16-6-4-13(21)10-17(16)25(27)28;/h2-8,10-11,26H,1,9,21H2;1H4/b23-22+; |
| InChIKey | KQKUOQRRVLCYKM-PGCQSHBKSA-N |
| XLogP | 5.83 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.87 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|