C13H9N5O3S — CID 143874148
4-amino-2-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]phenol (PubChem CID 143874148) has the molecular formula C13H9N5O3S and a molecular weight of 315.31 g/mol. Its IUPAC name is 4-amino-2-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]phenol.
| Compound Name | 4-amino-2-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]phenol |
|---|---|
| PubChem CID | 143874148 |
| Molecular Formula | C13H9N5O3S |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 4-amino-2-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]phenol |
| SMILES | Nc1ccc(O)c(/N=N/c2snc3ccc([N+](=O)[O-])cc23)c1 |
| InChI | InChI=1S/C13H9N5O3S/c14-7-1-4-12(19)11(5-7)15-16-13-9-6-8(18(20)21)2-3-10(9)17-22-13/h1-6,19H,14H2/b16-15+ |
| InChIKey | JTVNKERCGYNFGX-FOCLMDBBSA-N |
| XLogP | 3.91 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|