C24H14ClN5O4S — CID 136731060
N-(4-chlorophenyl)-3-hydroxy-4-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]naphthalene-2-carboxamide (PubChem CID 136731060) has the molecular formula C24H14ClN5O4S and a molecular weight of 503.93 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-hydroxy-4-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]naphthalene-2-carboxamide.
| Compound Name | N-(4-chlorophenyl)-3-hydroxy-4-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 136731060 |
| Molecular Formula | C24H14ClN5O4S |
| Molecular Weight | 503.93 g/mol |
| Exact Mass | 503.05 |
| IUPAC Name | N-(4-chlorophenyl)-3-hydroxy-4-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]naphthalene-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1cc2ccccc2c(/N=N/c2snc3ccc([N+](=O)[O-])cc23)c1O |
| InChI | InChI=1S/C24H14ClN5O4S/c25-14-5-7-15(8-6-14)26-23(32)19-11-13-3-1-2-4-17(13)21(22(19)31)27-28-24-18-12-16(30(33)34)9-10-20(18)29-35-24/h1-12,31H,(H,26,32)/b28-27+ |
| InChIKey | LRKCGNQMMHGADP-BYYHNAKLSA-N |
| XLogP | 7.38 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.93 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|