C25H16ClN5O4S — CID 136731061
N-(4-chloro-2-methylphenyl)-3-hydroxy-4-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]naphthalene-2-carboxamide (PubChem CID 136731061) has the molecular formula C25H16ClN5O4S and a molecular weight of 517.95 g/mol. Its IUPAC name is N-(4-chloro-2-methylphenyl)-3-hydroxy-4-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]naphthalene-2-carboxamide.
| Compound Name | N-(4-chloro-2-methylphenyl)-3-hydroxy-4-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 136731061 |
| Molecular Formula | C25H16ClN5O4S |
| Molecular Weight | 517.95 g/mol |
| Exact Mass | 517.06 |
| IUPAC Name | N-(4-chloro-2-methylphenyl)-3-hydroxy-4-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]naphthalene-2-carboxamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)c1cc2ccccc2c(/N=N/c2snc3ccc([N+](=O)[O-])cc23)c1O |
| InChI | InChI=1S/C25H16ClN5O4S/c1-13-10-15(26)6-8-20(13)27-24(33)19-11-14-4-2-3-5-17(14)22(23(19)32)28-29-25-18-12-16(31(34)35)7-9-21(18)30-36-25/h2-12,32H,1H3,(H,27,33)/b29-28+ |
| InChIKey | QNUNMEYOXIXRGQ-ZQHSETAFSA-N |
| XLogP | 7.69 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.95 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|