C15H13N5O3S — CID 59730715
2-[4-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]anilino]ethanol (PubChem CID 59730715) has the molecular formula C15H13N5O3S and a molecular weight of 343.37 g/mol. Its IUPAC name is 2-[4-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]anilino]ethanol.
| Compound Name | 2-[4-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]anilino]ethanol |
|---|---|
| PubChem CID | 59730715 |
| Molecular Formula | C15H13N5O3S |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 2-[4-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]anilino]ethanol |
| SMILES | O=[N+]([O-])c1ccc2nsc(/N=N/c3ccc(NCCO)cc3)c2c1 |
| InChI | InChI=1S/C15H13N5O3S/c21-8-7-16-10-1-3-11(4-2-10)17-18-15-13-9-12(20(22)23)5-6-14(13)19-24-15/h1-6,9,16,21H,7-8H2/b18-17+ |
| InChIKey | MOQNFAGDRWFVAU-ISLYRVAYSA-N |
| XLogP | 4.02 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|