C23H21N5O2S — CID 15404927
N-benzyl-N-ethyl-3-methyl-4-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]aniline (PubChem CID 15404927) has the molecular formula C23H21N5O2S and a molecular weight of 431.52 g/mol. Its IUPAC name is N-benzyl-N-ethyl-3-methyl-4-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]aniline.
| Compound Name | N-benzyl-N-ethyl-3-methyl-4-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]aniline |
|---|---|
| PubChem CID | 15404927 |
| Molecular Formula | C23H21N5O2S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N-benzyl-N-ethyl-3-methyl-4-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]aniline |
| SMILES | CCN(Cc1ccccc1)c1ccc(/N=N/c2snc3ccc([N+](=O)[O-])cc23)c(C)c1 |
| InChI | InChI=1S/C23H21N5O2S/c1-3-27(15-17-7-5-4-6-8-17)18-9-11-21(16(2)13-18)24-25-23-20-14-19(28(29)30)10-12-22(20)26-31-23/h4-14H,3,15H2,1-2H3/b25-24+ |
| InChIKey | ZVCUXPVZPZLISC-OCOZRVBESA-N |
| XLogP | 6.95 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|