C19H21N5O3S — CID 162487960
2-[N,3-diethyl-4-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]anilino]ethanol (PubChem CID 162487960) has the molecular formula C19H21N5O3S and a molecular weight of 399.48 g/mol. Its IUPAC name is 2-[N,3-diethyl-4-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]anilino]ethanol.
| Compound Name | 2-[N,3-diethyl-4-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]anilino]ethanol |
|---|---|
| PubChem CID | 162487960 |
| Molecular Formula | C19H21N5O3S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 2-[N,3-diethyl-4-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]anilino]ethanol |
| SMILES | CCc1cc(N(CC)CCO)ccc1/N=N/c1snc2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C19H21N5O3S/c1-3-13-11-14(23(4-2)9-10-25)5-7-17(13)20-21-19-16-12-15(24(26)27)6-8-18(16)22-28-19/h5-8,11-12,25H,3-4,9-10H2,1-2H3/b21-20+ |
| InChIKey | FYTPIWQRFONCPI-QZQOTICOSA-N |
| XLogP | 5.00 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|