C17H16N6O3S — CID 12598914
N-[5-(dimethylamino)-2-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]phenyl]acetamide (PubChem CID 12598914) has the molecular formula C17H16N6O3S and a molecular weight of 384.42 g/mol. Its IUPAC name is N-[5-(dimethylamino)-2-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]phenyl]acetamide.
| Compound Name | N-[5-(dimethylamino)-2-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 12598914 |
| Molecular Formula | C17H16N6O3S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | N-[5-(dimethylamino)-2-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(N(C)C)ccc1/N=N/c1snc2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C17H16N6O3S/c1-10(24)18-16-9-11(22(2)3)4-7-15(16)19-20-17-13-8-12(23(25)26)5-6-14(13)21-27-17/h4-9H,1-3H3,(H,18,24)/b20-19+ |
| InChIKey | HUSZWUHVKCMRSU-FMQUCBEESA-N |
| XLogP | 4.64 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|