C21H22N6O6 — CID 88847691
2-[[2-acetamido-4-[2-cyanoethyl(1-methoxyethyl)amino]phenyl]diazenyl]-5-nitrobenzoic acid (PubChem CID 88847691) has the molecular formula C21H22N6O6 and a molecular weight of 454.44 g/mol. Its IUPAC name is 2-[[2-acetamido-4-[2-cyanoethyl(1-methoxyethyl)amino]phenyl]diazenyl]-5-nitrobenzoic acid.
| Compound Name | 2-[[2-acetamido-4-[2-cyanoethyl(1-methoxyethyl)amino]phenyl]diazenyl]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 88847691 |
| Molecular Formula | C21H22N6O6 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 2-[[2-acetamido-4-[2-cyanoethyl(1-methoxyethyl)amino]phenyl]diazenyl]-5-nitrobenzoic acid |
| SMILES | COC(C)N(CCC#N)c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2C(=O)O)c(NC(C)=O)c1 |
| InChI | InChI=1S/C21H22N6O6/c1-13(28)23-20-12-15(26(10-4-9-22)14(2)33-3)5-8-19(20)25-24-18-7-6-16(27(31)32)11-17(18)21(29)30/h5-8,11-12,14H,4,10H2,1-3H3,(H,23,28)(H,29,30)/b25-24+ |
| InChIKey | XSSIFIZBIFVVSZ-OCOZRVBESA-N |
| XLogP | 4.38 |
| TPSA | 170.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|