C28H36ClN5O9 — CID 102503923
[1-[3-acetamido-N-(2-acetyloxy-3-ethoxypropyl)-4-[(2-chloro-4-nitrophenyl)diazenyl]anilino]-3-ethoxypropan-2-yl] acetate (PubChem CID 102503923) has the molecular formula C28H36ClN5O9 and a molecular weight of 622.08 g/mol. Its IUPAC name is [1-[3-acetamido-N-(2-acetyloxy-3-ethoxypropyl)-4-[(2-chloro-4-nitrophenyl)diazenyl]anilino]-3-ethoxypropan-2-yl] acetate.
| Compound Name | [1-[3-acetamido-N-(2-acetyloxy-3-ethoxypropyl)-4-[(2-chloro-4-nitrophenyl)diazenyl]anilino]-3-ethoxypropan-2-yl] acetate |
|---|---|
| PubChem CID | 102503923 |
| Molecular Formula | C28H36ClN5O9 |
| Molecular Weight | 622.08 g/mol |
| Exact Mass | 621.22 |
| IUPAC Name | [1-[3-acetamido-N-(2-acetyloxy-3-ethoxypropyl)-4-[(2-chloro-4-nitrophenyl)diazenyl]anilino]-3-ethoxypropan-2-yl] acetate |
| SMILES | CCOCC(CN(CC(COCC)OC(C)=O)c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2Cl)c(NC(C)=O)c1)OC(C)=O |
| InChI | InChI=1S/C28H36ClN5O9/c1-6-40-16-23(42-19(4)36)14-33(15-24(17-41-7-2)43-20(5)37)21-8-11-27(28(13-21)30-18(3)35)32-31-26-10-9-22(34(38)39)12-25(26)29/h8-13,23-24H,6-7,14-17H2,1-5H3,(H,30,35)/b32-31+ |
| InChIKey | WZORXLHRSVBLBW-QNEJGDQOSA-N |
| XLogP | 5.36 |
| TPSA | 171.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.08 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|