C27H21Cl3N8O3 — CID 23385977
N-[5-(4-chloro-N-ethylanilino)-2-[[4-cyano-1-(2,6-dichloro-4-nitrophenyl)-3-methylpyrazol-5-yl]diazenyl]phenyl]acetamide (PubChem CID 23385977) has the molecular formula C27H21Cl3N8O3 and a molecular weight of 611.88 g/mol. Its IUPAC name is N-[5-(4-chloro-N-ethylanilino)-2-[[4-cyano-1-(2,6-dichloro-4-nitrophenyl)-3-methylpyrazol-5-yl]diazenyl]phenyl]acetamide.
| Compound Name | N-[5-(4-chloro-N-ethylanilino)-2-[[4-cyano-1-(2,6-dichloro-4-nitrophenyl)-3-methylpyrazol-5-yl]diazenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 23385977 |
| Molecular Formula | C27H21Cl3N8O3 |
| Molecular Weight | 611.88 g/mol |
| Exact Mass | 610.08 |
| IUPAC Name | N-[5-(4-chloro-N-ethylanilino)-2-[[4-cyano-1-(2,6-dichloro-4-nitrophenyl)-3-methylpyrazol-5-yl]diazenyl]phenyl]acetamide |
| SMILES | CCN(c1ccc(Cl)cc1)c1ccc(/N=N/c2c(C#N)c(C)nn2-c2c(Cl)cc([N+](=O)[O-])cc2Cl)c(NC(C)=O)c1 |
| InChI | InChI=1S/C27H21Cl3N8O3/c1-4-36(18-7-5-17(28)6-8-18)19-9-10-24(25(13-19)32-16(3)39)33-34-27-21(14-31)15(2)35-37(27)26-22(29)11-20(38(40)41)12-23(26)30/h5-13H,4H2,1-3H3,(H,32,39)/b34-33+ |
| InChIKey | MJFZGLDUMHMSKH-JEIPZWNWSA-N |
| XLogP | 8.45 |
| TPSA | 141.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.88 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|