C35H30Cl2N8O2 — CID 23385960
N-[4-[5-[[2-acetamido-4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]diazenyl]-4-cyano-3-methylpyrazol-1-yl]-3,5-dichlorophenyl]acetamide (PubChem CID 23385960) has the molecular formula C35H30Cl2N8O2 and a molecular weight of 665.59 g/mol. Its IUPAC name is N-[4-[5-[[2-acetamido-4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]diazenyl]-4-cyano-3-methylpyrazol-1-yl]-3,5-dichlorophenyl]acetamide.
| Compound Name | N-[4-[5-[[2-acetamido-4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]diazenyl]-4-cyano-3-methylpyrazol-1-yl]-3,5-dichlorophenyl]acetamide |
|---|---|
| PubChem CID | 23385960 |
| Molecular Formula | C35H30Cl2N8O2 |
| Molecular Weight | 665.59 g/mol |
| Exact Mass | 664.19 |
| IUPAC Name | N-[4-[5-[[2-acetamido-4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]diazenyl]-4-cyano-3-methylpyrazol-1-yl]-3,5-dichlorophenyl]acetamide |
| SMILES | CC(=O)Nc1cc(Cl)c(-n2nc(C)c(C#N)c2/N=N/c2ccc(N(c3ccc(C)cc3)c3ccc(C)cc3)cc2NC(C)=O)c(Cl)c1 |
| InChI | InChI=1S/C35H30Cl2N8O2/c1-20-6-10-26(11-7-20)44(27-12-8-21(2)9-13-27)28-14-15-32(33(18-28)40-24(5)47)41-42-35-29(19-38)22(3)43-45(35)34-30(36)16-25(17-31(34)37)39-23(4)46/h6-18H,1-5H3,(H,39,46)(H,40,47)/b42-41+ |
| InChIKey | IGWDTTLMTGKUQE-WQVHNPAPSA-N |
| XLogP | 9.78 |
| TPSA | 127.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.59 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|