C32H33ClN10O — CID 21052368
N-[2-[[1-(2-chloro-4-cyano-5-isocyanophenyl)-4-cyano-3-methylpyrazol-5-yl]diazenyl]-5-[2-cyanoethyl(octyl)amino]phenyl]acetamide (PubChem CID 21052368) has the molecular formula C32H33ClN10O and a molecular weight of 609.14 g/mol. Its IUPAC name is N-[2-[[1-(2-chloro-4-cyano-5-isocyanophenyl)-4-cyano-3-methylpyrazol-5-yl]diazenyl]-5-[2-cyanoethyl(octyl)amino]phenyl]acetamide.
| Compound Name | N-[2-[[1-(2-chloro-4-cyano-5-isocyanophenyl)-4-cyano-3-methylpyrazol-5-yl]diazenyl]-5-[2-cyanoethyl(octyl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 21052368 |
| Molecular Formula | C32H33ClN10O |
| Molecular Weight | 609.14 g/mol |
| Exact Mass | 608.25 |
| IUPAC Name | N-[2-[[1-(2-chloro-4-cyano-5-isocyanophenyl)-4-cyano-3-methylpyrazol-5-yl]diazenyl]-5-[2-cyanoethyl(octyl)amino]phenyl]acetamide |
| SMILES | [C-]#[N+]c1cc(-n2nc(C)c(C#N)c2/N=N/c2ccc(N(CCC#N)CCCCCCCC)cc2NC(C)=O)c(Cl)cc1C#N |
| InChI | InChI=1S/C32H33ClN10O/c1-5-6-7-8-9-10-15-42(16-11-14-34)25-12-13-28(30(18-25)38-23(3)44)39-40-32-26(21-36)22(2)41-43(32)31-19-29(37-4)24(20-35)17-27(31)33/h12-13,17-19H,5-11,15-16H2,1-3H3,(H,38,44)/b40-39+ |
| InChIKey | BZWXVRPVQZQLKR-XQQUEIPISA-N |
| XLogP | 8.58 |
| TPSA | 150.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.14 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|