C36H34ClN11O — CID 21351139
1-[5-[2-aminoethynyl(octyl)amino]-2-[[1-(2-chloro-4,5-dicyanophenyl)-4-cyano-3-phenylpyrazol-5-yl]diazenyl]phenyl]-3-methylurea (PubChem CID 21351139) has the molecular formula C36H34ClN11O and a molecular weight of 672.20 g/mol. Its IUPAC name is 1-[5-[2-aminoethynyl(octyl)amino]-2-[[1-(2-chloro-4,5-dicyanophenyl)-4-cyano-3-phenylpyrazol-5-yl]diazenyl]phenyl]-3-methylurea.
| Compound Name | 1-[5-[2-aminoethynyl(octyl)amino]-2-[[1-(2-chloro-4,5-dicyanophenyl)-4-cyano-3-phenylpyrazol-5-yl]diazenyl]phenyl]-3-methylurea |
|---|---|
| PubChem CID | 21351139 |
| Molecular Formula | C36H34ClN11O |
| Molecular Weight | 672.20 g/mol |
| Exact Mass | 671.26 |
| IUPAC Name | 1-[5-[2-aminoethynyl(octyl)amino]-2-[[1-(2-chloro-4,5-dicyanophenyl)-4-cyano-3-phenylpyrazol-5-yl]diazenyl]phenyl]-3-methylurea |
| SMILES | CCCCCCCCN(C#CN)c1ccc(/N=N/c2c(C#N)c(-c3ccccc3)nn2-c2cc(C#N)c(C#N)cc2Cl)c(NC(=O)NC)c1 |
| InChI | InChI=1S/C36H34ClN11O/c1-3-4-5-6-7-11-17-47(18-16-38)28-14-15-31(32(21-28)43-36(49)42-2)44-45-35-29(24-41)34(25-12-9-8-10-13-25)46-48(35)33-20-27(23-40)26(22-39)19-30(33)37/h8-10,12-15,19-21H,3-7,11,17,38H2,1-2H3,(H2,42,43,49)/b45-44+ |
| InChIKey | SBONJOVZYDWQTO-JQOKOOLQSA-N |
| XLogP | 8.02 |
| TPSA | 184.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.20 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|