C32H38N8O3S — CID 21351255
N-[5-[2-aminoethynyl(octyl)amino]-2-[[4-cyano-1-(1,1-dioxothiolan-3-yl)-3-phenylpyrazol-5-yl]diazenyl]phenyl]acetamide (PubChem CID 21351255) has the molecular formula C32H38N8O3S and a molecular weight of 614.78 g/mol. Its IUPAC name is N-[5-[2-aminoethynyl(octyl)amino]-2-[[4-cyano-1-(1,1-dioxothiolan-3-yl)-3-phenylpyrazol-5-yl]diazenyl]phenyl]acetamide.
| Compound Name | N-[5-[2-aminoethynyl(octyl)amino]-2-[[4-cyano-1-(1,1-dioxothiolan-3-yl)-3-phenylpyrazol-5-yl]diazenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 21351255 |
| Molecular Formula | C32H38N8O3S |
| Molecular Weight | 614.78 g/mol |
| Exact Mass | 614.28 |
| IUPAC Name | N-[5-[2-aminoethynyl(octyl)amino]-2-[[4-cyano-1-(1,1-dioxothiolan-3-yl)-3-phenylpyrazol-5-yl]diazenyl]phenyl]acetamide |
| SMILES | CCCCCCCCN(C#CN)c1ccc(/N=N/c2c(C#N)c(-c3ccccc3)nn2C2CCS(=O)(=O)C2)c(NC(C)=O)c1 |
| InChI | InChI=1S/C32H38N8O3S/c1-3-4-5-6-7-11-18-39(19-17-33)26-14-15-29(30(21-26)35-24(2)41)36-37-32-28(22-34)31(25-12-9-8-10-13-25)38-40(32)27-16-20-44(42,43)23-27/h8-10,12-15,21,27H,3-7,11,16,18,20,23,33H2,1-2H3,(H,35,41)/b37-36+ |
| InChIKey | ZTGAQYRCNJVDDR-BSRQYYOTSA-N |
| XLogP | 6.20 |
| TPSA | 158.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.78 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|