C27H30Cl2N8O2 — CID 89321861
N-[2-[[3-tert-butyl-4-cyano-1-(2,6-dichloro-4-formamidophenyl)pyrazol-5-yl]diazenyl]-5-(diethylamino)phenyl]acetamide (PubChem CID 89321861) has the molecular formula C27H30Cl2N8O2 and a molecular weight of 569.50 g/mol. Its IUPAC name is N-[2-[[3-tert-butyl-4-cyano-1-(2,6-dichloro-4-formamidophenyl)pyrazol-5-yl]diazenyl]-5-(diethylamino)phenyl]acetamide.
| Compound Name | N-[2-[[3-tert-butyl-4-cyano-1-(2,6-dichloro-4-formamidophenyl)pyrazol-5-yl]diazenyl]-5-(diethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 89321861 |
| Molecular Formula | C27H30Cl2N8O2 |
| Molecular Weight | 569.50 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | N-[2-[[3-tert-butyl-4-cyano-1-(2,6-dichloro-4-formamidophenyl)pyrazol-5-yl]diazenyl]-5-(diethylamino)phenyl]acetamide |
| SMILES | CCN(CC)c1ccc(/N=N/c2c(C#N)c(C(C)(C)C)nn2-c2c(Cl)cc(NC=O)cc2Cl)c(NC(C)=O)c1 |
| InChI | InChI=1S/C27H30Cl2N8O2/c1-7-36(8-2)18-9-10-22(23(13-18)32-16(3)39)33-34-26-19(14-30)25(27(4,5)6)35-37(26)24-20(28)11-17(31-15-38)12-21(24)29/h9-13,15H,7-8H2,1-6H3,(H,31,38)(H,32,39)/b34-33+ |
| InChIKey | MNYLEQDJPIPJPJ-JEIPZWNWSA-N |
| XLogP | 7.14 |
| TPSA | 127.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.50 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|