C30H45N7O3 — CID 135682075
ethyl 4-[3-acetamido-4-[(5-tert-butyl-4-cyano-1H-pyrazol-3-yl)diazenyl]-N-octylanilino]butanoate (PubChem CID 135682075) has the molecular formula C30H45N7O3 and a molecular weight of 551.74 g/mol. Its IUPAC name is ethyl 4-[3-acetamido-4-[(5-tert-butyl-4-cyano-1H-pyrazol-3-yl)diazenyl]-N-octylanilino]butanoate.
| Compound Name | ethyl 4-[3-acetamido-4-[(5-tert-butyl-4-cyano-1H-pyrazol-3-yl)diazenyl]-N-octylanilino]butanoate |
|---|---|
| PubChem CID | 135682075 |
| Molecular Formula | C30H45N7O3 |
| Molecular Weight | 551.74 g/mol |
| Exact Mass | 551.36 |
| IUPAC Name | ethyl 4-[3-acetamido-4-[(5-tert-butyl-4-cyano-1H-pyrazol-3-yl)diazenyl]-N-octylanilino]butanoate |
| SMILES | CCCCCCCCN(CCCC(=O)OCC)c1ccc(/N=N/c2n[nH]c(C(C)(C)C)c2C#N)c(NC(C)=O)c1 |
| InChI | InChI=1S/C30H45N7O3/c1-7-9-10-11-12-13-18-37(19-14-15-27(39)40-8-2)23-16-17-25(26(20-23)32-22(3)38)33-35-29-24(21-31)28(34-36-29)30(4,5)6/h16-17,20H,7-15,18-19H2,1-6H3,(H,32,38)(H,34,36)/b35-33+ |
| InChIKey | XZPUJMBOSRERDS-LAPDZXRHSA-N |
| XLogP | 7.46 |
| TPSA | 135.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.74 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|