C35H49N5O7S — CID 89282988
2-[2-[2-[2-[2-[4-[(3,5-dicyano-4-methylthiophen-2-yl)diazenyl]-N-hexyl-3-methylanilino]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 5-oxopentanoate (PubChem CID 89282988) has the molecular formula C35H49N5O7S and a molecular weight of 683.87 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[4-[(3,5-dicyano-4-methylthiophen-2-yl)diazenyl]-N-hexyl-3-methylanilino]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 5-oxopentanoate.
| Compound Name | 2-[2-[2-[2-[2-[4-[(3,5-dicyano-4-methylthiophen-2-yl)diazenyl]-N-hexyl-3-methylanilino]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 5-oxopentanoate |
|---|---|
| PubChem CID | 89282988 |
| Molecular Formula | C35H49N5O7S |
| Molecular Weight | 683.87 g/mol |
| Exact Mass | 683.34 |
| IUPAC Name | 2-[2-[2-[2-[2-[4-[(3,5-dicyano-4-methylthiophen-2-yl)diazenyl]-N-hexyl-3-methylanilino]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 5-oxopentanoate |
| SMILES | CCCCCCN(CCOCCOCCOCCOCCOC(=O)CCCC=O)c1ccc(/N=N/c2sc(C#N)c(C)c2C#N)c(C)c1 |
| InChI | InChI=1S/C35H49N5O7S/c1-4-5-6-8-13-40(30-11-12-32(28(2)25-30)38-39-35-31(26-36)29(3)33(27-37)48-35)14-16-43-17-18-44-19-20-45-21-22-46-23-24-47-34(42)10-7-9-15-41/h11-12,15,25H,4-10,13-14,16-24H2,1-3H3/b39-38+ |
| InChIKey | PCCRBUCJHXDTMK-YMZYAJTMSA-N |
| XLogP | 6.89 |
| TPSA | 155.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.87 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|