C43H63N5O8S — CID 159975538
4-O-[2-[2-[2-[2-[2-[4-[(5-cyano-3-isocyano-4-methylthiophen-2-yl)diazenyl]-N-hexyl-3-methylanilino]ethoxy]ethoxy]ethoxy]ethoxy]ethyl] 1-O-methyl 2-[(E)-oct-2-enyl]butanedioate (PubChem CID 159975538) has the molecular formula C43H63N5O8S and a molecular weight of 810.07 g/mol. Its IUPAC name is 4-O-[2-[2-[2-[2-[2-[4-[(5-cyano-3-isocyano-4-methylthiophen-2-yl)diazenyl]-N-hexyl-3-methylanilino]ethoxy]ethoxy]ethoxy]ethoxy]ethyl] 1-O-methyl 2-[(E)-oct-2-enyl]butanedioate.
| Compound Name | 4-O-[2-[2-[2-[2-[2-[4-[(5-cyano-3-isocyano-4-methylthiophen-2-yl)diazenyl]-N-hexyl-3-methylanilino]ethoxy]ethoxy]ethoxy]ethoxy]ethyl] 1-O-methyl 2-[(E)-oct-2-enyl]butanedioate |
|---|---|
| PubChem CID | 159975538 |
| Molecular Formula | C43H63N5O8S |
| Molecular Weight | 810.07 g/mol |
| Exact Mass | 809.44 |
| IUPAC Name | 4-O-[2-[2-[2-[2-[2-[4-[(5-cyano-3-isocyano-4-methylthiophen-2-yl)diazenyl]-N-hexyl-3-methylanilino]ethoxy]ethoxy]ethoxy]ethoxy]ethyl] 1-O-methyl 2-[(E)-oct-2-enyl]butanedioate |
| SMILES | [C-]#[N+]c1c(/N=N/c2ccc(N(CCCCCC)CCOCCOCCOCCOCCOC(=O)CC(C/C=C/CCCCC)C(=O)OC)cc2C)sc(C#N)c1C |
| InChI | InChI=1S/C43H63N5O8S/c1-7-9-11-13-14-15-17-36(43(50)51-6)32-40(49)56-30-29-55-28-27-54-26-25-53-24-23-52-22-21-48(20-16-12-10-8-2)37-18-19-38(34(3)31-37)46-47-42-41(45-5)35(4)39(33-44)57-42/h14-15,18-19,31,36H,7-13,16-17,20-30,32H2,1-4,6H3/b15-14+,47-46+ |
| InChIKey | OFCKKFRRUXBIQK-KKYZXJLCSA-N |
| XLogP | 9.91 |
| TPSA | 145.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.07 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|