C30H45N6O4S+ — CID 87849786
2-[2-[2-[2-[2-[4-[(5-cyano-3-isocyano-4-methylthiophen-2-yl)diazenyl]-N-ethyl-3-methylanilino]ethoxy]ethoxy]ethoxy]ethoxy]ethyl-ethyl-dimethylazanium (PubChem CID 87849786) has the molecular formula C30H45N6O4S+ and a molecular weight of 585.80 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[4-[(5-cyano-3-isocyano-4-methylthiophen-2-yl)diazenyl]-N-ethyl-3-methylanilino]ethoxy]ethoxy]ethoxy]ethoxy]ethyl-ethyl-dimethylazanium.
| Compound Name | 2-[2-[2-[2-[2-[4-[(5-cyano-3-isocyano-4-methylthiophen-2-yl)diazenyl]-N-ethyl-3-methylanilino]ethoxy]ethoxy]ethoxy]ethoxy]ethyl-ethyl-dimethylazanium |
|---|---|
| PubChem CID | 87849786 |
| Molecular Formula | C30H45N6O4S+ |
| Molecular Weight | 585.80 g/mol |
| Exact Mass | 585.32 |
| IUPAC Name | 2-[2-[2-[2-[2-[4-[(5-cyano-3-isocyano-4-methylthiophen-2-yl)diazenyl]-N-ethyl-3-methylanilino]ethoxy]ethoxy]ethoxy]ethoxy]ethyl-ethyl-dimethylazanium |
| SMILES | [C-]#[N+]c1c(/N=N/c2ccc(N(CC)CCOCCOCCOCCOCC[N+](C)(C)CC)cc2C)sc(C#N)c1C |
| InChI | InChI=1S/C30H45N6O4S/c1-8-35(12-14-37-16-18-39-20-21-40-19-17-38-15-13-36(6,7)9-2)26-10-11-27(24(3)22-26)33-34-30-29(32-5)25(4)28(23-31)41-30/h10-11,22H,8-9,12-21H2,1-4,6-7H3/q+1/b34-33+ |
| InChIKey | LEDKHMLCEGAZBG-JEIPZWNWSA-N |
| XLogP | 6.19 |
| TPSA | 93.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.80 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|