C33H29N5O5S — CID 140665406
2-[2-[2-[N-benzyl-4-[(5-cyano-3-isocyano-4-methylthiophen-2-yl)diazenyl]-3-methylanilino]ethoxy]ethoxycarbonyl]benzoic acid (PubChem CID 140665406) has the molecular formula C33H29N5O5S and a molecular weight of 607.69 g/mol. Its IUPAC name is 2-[2-[2-[N-benzyl-4-[(5-cyano-3-isocyano-4-methylthiophen-2-yl)diazenyl]-3-methylanilino]ethoxy]ethoxycarbonyl]benzoic acid.
| Compound Name | 2-[2-[2-[N-benzyl-4-[(5-cyano-3-isocyano-4-methylthiophen-2-yl)diazenyl]-3-methylanilino]ethoxy]ethoxycarbonyl]benzoic acid |
|---|---|
| PubChem CID | 140665406 |
| Molecular Formula | C33H29N5O5S |
| Molecular Weight | 607.69 g/mol |
| Exact Mass | 607.19 |
| IUPAC Name | 2-[2-[2-[N-benzyl-4-[(5-cyano-3-isocyano-4-methylthiophen-2-yl)diazenyl]-3-methylanilino]ethoxy]ethoxycarbonyl]benzoic acid |
| SMILES | [C-]#[N+]c1c(/N=N/c2ccc(N(CCOCCOC(=O)c3ccccc3C(=O)O)Cc3ccccc3)cc2C)sc(C#N)c1C |
| InChI | InChI=1S/C33H29N5O5S/c1-22-19-25(13-14-28(22)36-37-31-30(35-3)23(2)29(20-34)44-31)38(21-24-9-5-4-6-10-24)15-16-42-17-18-43-33(41)27-12-8-7-11-26(27)32(39)40/h4-14,19H,15-18,21H2,1-2H3,(H,39,40)/b37-36+ |
| InChIKey | LPIJFJMMADGVQE-BSRQYYOTSA-N |
| XLogP | 7.78 |
| TPSA | 128.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.69 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|