C39H49N5O9S — CID 146790773
4-O-[2-[2-[2-[2-[2-[2-[4-[(5-cyano-3-isocyano-4-methylthiophen-2-yl)diazenyl]-N-ethyl-3-methylanilino]-1-phenylethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl] 1-O-methyl butanedioate (PubChem CID 146790773) has the molecular formula C39H49N5O9S and a molecular weight of 763.91 g/mol. Its IUPAC name is 4-O-[2-[2-[2-[2-[2-[2-[4-[(5-cyano-3-isocyano-4-methylthiophen-2-yl)diazenyl]-N-ethyl-3-methylanilino]-1-phenylethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl] 1-O-methyl butanedioate.
| Compound Name | 4-O-[2-[2-[2-[2-[2-[2-[4-[(5-cyano-3-isocyano-4-methylthiophen-2-yl)diazenyl]-N-ethyl-3-methylanilino]-1-phenylethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl] 1-O-methyl butanedioate |
|---|---|
| PubChem CID | 146790773 |
| Molecular Formula | C39H49N5O9S |
| Molecular Weight | 763.91 g/mol |
| Exact Mass | 763.33 |
| IUPAC Name | 4-O-[2-[2-[2-[2-[2-[2-[4-[(5-cyano-3-isocyano-4-methylthiophen-2-yl)diazenyl]-N-ethyl-3-methylanilino]-1-phenylethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl] 1-O-methyl butanedioate |
| SMILES | [C-]#[N+]c1c(/N=N/c2ccc(N(CC)CC(OCCOCCOCCOCCOCCOC(=O)CCC(=O)OC)c3ccccc3)cc2C)sc(C#N)c1C |
| InChI | InChI=1S/C39H49N5O9S/c1-6-44(32-12-13-33(29(2)26-32)42-43-39-38(41-4)30(3)35(27-40)54-39)28-34(31-10-8-7-9-11-31)52-24-22-50-20-18-48-16-17-49-19-21-51-23-25-53-37(46)15-14-36(45)47-5/h7-13,26,34H,6,14-25,28H2,1-3,5H3/b43-42+ |
| InChIKey | RVTWMPWBHWZZBU-HBSCQBRPSA-N |
| XLogP | 7.35 |
| TPSA | 154.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.91 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|