C39H49N5O8S — CID 148534874
2-O-[2-[2-[2-[2-[2-[4-[(5-cyano-3-isocyano-4-methylthiophen-2-yl)diazenyl]-N-hexyl-3-methylanilino]ethoxy]ethoxy]ethoxy]ethoxy]ethyl] 1-O-methyl benzene-1,2-dicarboxylate (PubChem CID 148534874) has the molecular formula C39H49N5O8S and a molecular weight of 747.91 g/mol. Its IUPAC name is 2-O-[2-[2-[2-[2-[2-[4-[(5-cyano-3-isocyano-4-methylthiophen-2-yl)diazenyl]-N-hexyl-3-methylanilino]ethoxy]ethoxy]ethoxy]ethoxy]ethyl] 1-O-methyl benzene-1,2-dicarboxylate.
| Compound Name | 2-O-[2-[2-[2-[2-[2-[4-[(5-cyano-3-isocyano-4-methylthiophen-2-yl)diazenyl]-N-hexyl-3-methylanilino]ethoxy]ethoxy]ethoxy]ethoxy]ethyl] 1-O-methyl benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 148534874 |
| Molecular Formula | C39H49N5O8S |
| Molecular Weight | 747.91 g/mol |
| Exact Mass | 747.33 |
| IUPAC Name | 2-O-[2-[2-[2-[2-[2-[4-[(5-cyano-3-isocyano-4-methylthiophen-2-yl)diazenyl]-N-hexyl-3-methylanilino]ethoxy]ethoxy]ethoxy]ethoxy]ethyl] 1-O-methyl benzene-1,2-dicarboxylate |
| SMILES | [C-]#[N+]c1c(/N=N/c2ccc(N(CCCCCC)CCOCCOCCOCCOCCOC(=O)c3ccccc3C(=O)OC)cc2C)sc(C#N)c1C |
| InChI | InChI=1S/C39H49N5O8S/c1-6-7-8-11-16-44(31-14-15-34(29(2)27-31)42-43-37-36(41-4)30(3)35(28-40)53-37)17-18-48-19-20-49-21-22-50-23-24-51-25-26-52-39(46)33-13-10-9-12-32(33)38(45)47-5/h9-10,12-15,27H,6-8,11,16-26H2,1-3,5H3/b43-42+ |
| InChIKey | MQZQHTGPDLKFRZ-HBSCQBRPSA-N |
| XLogP | 8.30 |
| TPSA | 145.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.91 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|