C24H31N5O2S — CID 147985048
5-[[4-[hexyl-[2-(2-hydroxyethoxy)ethyl]amino]-2-methylphenyl]diazenyl]-3-methylthiophene-2,4-dicarbonitrile (PubChem CID 147985048) has the molecular formula C24H31N5O2S and a molecular weight of 453.61 g/mol. Its IUPAC name is 5-[[4-[hexyl-[2-(2-hydroxyethoxy)ethyl]amino]-2-methylphenyl]diazenyl]-3-methylthiophene-2,4-dicarbonitrile.
| Compound Name | 5-[[4-[hexyl-[2-(2-hydroxyethoxy)ethyl]amino]-2-methylphenyl]diazenyl]-3-methylthiophene-2,4-dicarbonitrile |
|---|---|
| PubChem CID | 147985048 |
| Molecular Formula | C24H31N5O2S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 5-[[4-[hexyl-[2-(2-hydroxyethoxy)ethyl]amino]-2-methylphenyl]diazenyl]-3-methylthiophene-2,4-dicarbonitrile |
| SMILES | CCCCCCN(CCOCCO)c1ccc(/N=N/c2sc(C#N)c(C)c2C#N)c(C)c1 |
| InChI | InChI=1S/C24H31N5O2S/c1-4-5-6-7-10-29(11-13-31-14-12-30)20-8-9-22(18(2)15-20)27-28-24-21(16-25)19(3)23(17-26)32-24/h8-9,15,30H,4-7,10-14H2,1-3H3/b28-27+ |
| InChIKey | ITYZLTGJDXKNFN-BYYHNAKLSA-N |
| XLogP | 5.92 |
| TPSA | 105.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|