C26H37N6S+ — CID 118088169
4-[4-[(3,5-dicyano-4-methylthiophen-2-yl)diazenyl]-N-ethyl-3-methylanilino]butyl-triethylazanium (PubChem CID 118088169) has the molecular formula C26H37N6S+ and a molecular weight of 465.69 g/mol. Its IUPAC name is 4-[4-[(3,5-dicyano-4-methylthiophen-2-yl)diazenyl]-N-ethyl-3-methylanilino]butyl-triethylazanium.
| Compound Name | 4-[4-[(3,5-dicyano-4-methylthiophen-2-yl)diazenyl]-N-ethyl-3-methylanilino]butyl-triethylazanium |
|---|---|
| PubChem CID | 118088169 |
| Molecular Formula | C26H37N6S+ |
| Molecular Weight | 465.69 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | 4-[4-[(3,5-dicyano-4-methylthiophen-2-yl)diazenyl]-N-ethyl-3-methylanilino]butyl-triethylazanium |
| SMILES | CCN(CCCC[N+](CC)(CC)CC)c1ccc(/N=N/c2sc(C#N)c(C)c2C#N)c(C)c1 |
| InChI | InChI=1S/C26H37N6S/c1-7-31(15-11-12-16-32(8-2,9-3)10-4)22-13-14-24(20(5)17-22)29-30-26-23(18-27)21(6)25(19-28)33-26/h13-14,17H,7-12,15-16H2,1-6H3/q+1/b30-29+ |
| InChIKey | JXTOTKGVUSXORT-QVIHXGFCSA-N |
| XLogP | 7.01 |
| TPSA | 75.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.69 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|