C36H59N7O3S+2 — CID 87850328
2-[2-[4-[(5-cyano-3-isocyano-4-methylthiophen-2-yl)diazenyl]-3-methyl-N-[2-[2-[2-(triethylazaniumyl)ethoxy]ethoxy]ethyl]anilino]ethoxy]ethyl-triethylazanium (PubChem CID 87850328) has the molecular formula C36H59N7O3S+2 and a molecular weight of 669.98 g/mol. Its IUPAC name is 2-[2-[4-[(5-cyano-3-isocyano-4-methylthiophen-2-yl)diazenyl]-3-methyl-N-[2-[2-[2-(triethylazaniumyl)ethoxy]ethoxy]ethyl]anilino]ethoxy]ethyl-triethylazanium.
| Compound Name | 2-[2-[4-[(5-cyano-3-isocyano-4-methylthiophen-2-yl)diazenyl]-3-methyl-N-[2-[2-[2-(triethylazaniumyl)ethoxy]ethoxy]ethyl]anilino]ethoxy]ethyl-triethylazanium |
|---|---|
| PubChem CID | 87850328 |
| Molecular Formula | C36H59N7O3S+2 |
| Molecular Weight | 669.98 g/mol |
| Exact Mass | 669.44 |
| IUPAC Name | 2-[2-[4-[(5-cyano-3-isocyano-4-methylthiophen-2-yl)diazenyl]-3-methyl-N-[2-[2-[2-(triethylazaniumyl)ethoxy]ethoxy]ethyl]anilino]ethoxy]ethyl-triethylazanium |
| SMILES | [C-]#[N+]c1c(/N=N/c2ccc(N(CCOCCOCC[N+](CC)(CC)CC)CCOCC[N+](CC)(CC)CC)cc2C)sc(C#N)c1C |
| InChI | InChI=1S/C36H59N7O3S/c1-10-42(11-2,12-3)20-24-44-22-18-41(19-23-45-26-27-46-25-21-43(13-4,14-5)15-6)32-16-17-33(30(7)28-32)39-40-36-35(38-9)31(8)34(29-37)47-36/h16-17,28H,10-15,18-27H2,1-8H3/q+2/b40-39+ |
| InChIKey | OORKCRQKJAYRKM-XQQUEIPISA-N |
| XLogP | 7.81 |
| TPSA | 83.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.98 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|