C24H28N7OS+ — CID 87849830
5-[[4-[ethyl-[2-[2-(3-methylimidazol-3-ium-1-yl)ethoxy]ethyl]amino]-2-methylphenyl]diazenyl]-4-isocyano-3-methylthiophene-2-carbonitrile (PubChem CID 87849830) has the molecular formula C24H28N7OS+ and a molecular weight of 462.60 g/mol. Its IUPAC name is 5-[[4-[ethyl-[2-[2-(3-methylimidazol-3-ium-1-yl)ethoxy]ethyl]amino]-2-methylphenyl]diazenyl]-4-isocyano-3-methylthiophene-2-carbonitrile.
| Compound Name | 5-[[4-[ethyl-[2-[2-(3-methylimidazol-3-ium-1-yl)ethoxy]ethyl]amino]-2-methylphenyl]diazenyl]-4-isocyano-3-methylthiophene-2-carbonitrile |
|---|---|
| PubChem CID | 87849830 |
| Molecular Formula | C24H28N7OS+ |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 5-[[4-[ethyl-[2-[2-(3-methylimidazol-3-ium-1-yl)ethoxy]ethyl]amino]-2-methylphenyl]diazenyl]-4-isocyano-3-methylthiophene-2-carbonitrile |
| SMILES | [C-]#[N+]c1c(/N=N/c2ccc(N(CC)CCOCCn3cc[n+](C)c3)cc2C)sc(C#N)c1C |
| InChI | InChI=1S/C24H28N7OS/c1-6-31(12-14-32-13-11-30-10-9-29(5)17-30)20-7-8-21(18(2)15-20)27-28-24-23(26-4)19(3)22(16-25)33-24/h7-10,15,17H,6,11-14H2,1-3,5H3/q+1/b28-27+ |
| InChIKey | NQKVEFVHOQFQIA-BYYHNAKLSA-N |
| XLogP | 5.37 |
| TPSA | 74.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|