C25H33N5O4S — CID 160775583
5-[[4-[2-(2-hydroxyethoxy)ethyl-[2-(2-propoxyethoxy)ethyl]amino]-2-methylphenyl]diazenyl]-3-methylthiophene-2,4-dicarbonitrile (PubChem CID 160775583) has the molecular formula C25H33N5O4S and a molecular weight of 499.64 g/mol. Its IUPAC name is 5-[[4-[2-(2-hydroxyethoxy)ethyl-[2-(2-propoxyethoxy)ethyl]amino]-2-methylphenyl]diazenyl]-3-methylthiophene-2,4-dicarbonitrile.
| Compound Name | 5-[[4-[2-(2-hydroxyethoxy)ethyl-[2-(2-propoxyethoxy)ethyl]amino]-2-methylphenyl]diazenyl]-3-methylthiophene-2,4-dicarbonitrile |
|---|---|
| PubChem CID | 160775583 |
| Molecular Formula | C25H33N5O4S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 5-[[4-[2-(2-hydroxyethoxy)ethyl-[2-(2-propoxyethoxy)ethyl]amino]-2-methylphenyl]diazenyl]-3-methylthiophene-2,4-dicarbonitrile |
| SMILES | CCCOCCOCCN(CCOCCO)c1ccc(/N=N/c2sc(C#N)c(C)c2C#N)c(C)c1 |
| InChI | InChI=1S/C25H33N5O4S/c1-4-10-32-14-15-34-12-8-30(7-11-33-13-9-31)21-5-6-23(19(2)16-21)28-29-25-22(17-26)20(3)24(18-27)35-25/h5-6,16,31H,4,7-15H2,1-3H3/b29-28+ |
| InChIKey | HZVHYBGQDJXKGZ-ZQHSETAFSA-N |
| XLogP | 4.78 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|