C32H49N6O4S+ — CID 87850296
butyl-[2-[2-[2-[2-[2-[4-[(5-cyano-3-isocyano-4-methylthiophen-2-yl)diazenyl]-N-ethyl-3-methylanilino]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-dimethylazanium (PubChem CID 87850296) has the molecular formula C32H49N6O4S+ and a molecular weight of 613.85 g/mol. Its IUPAC name is butyl-[2-[2-[2-[2-[2-[4-[(5-cyano-3-isocyano-4-methylthiophen-2-yl)diazenyl]-N-ethyl-3-methylanilino]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-dimethylazanium.
| Compound Name | butyl-[2-[2-[2-[2-[2-[4-[(5-cyano-3-isocyano-4-methylthiophen-2-yl)diazenyl]-N-ethyl-3-methylanilino]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 87850296 |
| Molecular Formula | C32H49N6O4S+ |
| Molecular Weight | 613.85 g/mol |
| Exact Mass | 613.35 |
| IUPAC Name | butyl-[2-[2-[2-[2-[2-[4-[(5-cyano-3-isocyano-4-methylthiophen-2-yl)diazenyl]-N-ethyl-3-methylanilino]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-dimethylazanium |
| SMILES | [C-]#[N+]c1c(/N=N/c2ccc(N(CC)CCOCCOCCOCCOCC[N+](C)(C)CCCC)cc2C)sc(C#N)c1C |
| InChI | InChI=1S/C32H49N6O4S/c1-8-10-14-38(6,7)15-17-40-19-21-42-23-22-41-20-18-39-16-13-37(9-2)28-11-12-29(26(3)24-28)35-36-32-31(34-5)27(4)30(25-33)43-32/h11-12,24H,8-10,13-23H2,1-4,6-7H3/q+1/b36-35+ |
| InChIKey | ASNHPMSLFRYVMT-ULDVOPSXSA-N |
| XLogP | 6.97 |
| TPSA | 93.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.85 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|