C24H33N5O6S — CID 159353914
2-[[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl-[2-(2-hydroxyethoxy)ethyl]amino]-2-methylphenyl]diazenyl]-5-isocyano-4-methylthiophene-3-carboxamide (PubChem CID 159353914) has the molecular formula C24H33N5O6S and a molecular weight of 519.62 g/mol. Its IUPAC name is 2-[[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl-[2-(2-hydroxyethoxy)ethyl]amino]-2-methylphenyl]diazenyl]-5-isocyano-4-methylthiophene-3-carboxamide.
| Compound Name | 2-[[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl-[2-(2-hydroxyethoxy)ethyl]amino]-2-methylphenyl]diazenyl]-5-isocyano-4-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 159353914 |
| Molecular Formula | C24H33N5O6S |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | 2-[[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl-[2-(2-hydroxyethoxy)ethyl]amino]-2-methylphenyl]diazenyl]-5-isocyano-4-methylthiophene-3-carboxamide |
| SMILES | [C-]#[N+]c1sc(/N=N/c2ccc(N(CCOCCO)CCOCCOCCO)cc2C)c(C(N)=O)c1C |
| InChI | InChI=1S/C24H33N5O6S/c1-17-16-19(29(6-10-33-12-8-30)7-11-34-14-15-35-13-9-31)4-5-20(17)27-28-24-21(22(25)32)18(2)23(26-3)36-24/h4-5,16,30-31H,6-15H2,1-2H3,(H2,25,32)/b28-27+ |
| InChIKey | WFWCXYUQYABGNN-BYYHNAKLSA-N |
| XLogP | 3.27 |
| TPSA | 143.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|