C22H32N4O7S — CID 87572921
2-[2-[[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl-[2-(2-hydroxyethoxy)ethyl]amino]-2-methylphenyl]diazenyl]-1,3-thiazol-3-ium-3-yl]acetate (PubChem CID 87572921) has the molecular formula C22H32N4O7S and a molecular weight of 496.59 g/mol. Its IUPAC name is 2-[2-[[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl-[2-(2-hydroxyethoxy)ethyl]amino]-2-methylphenyl]diazenyl]-1,3-thiazol-3-ium-3-yl]acetate.
| Compound Name | 2-[2-[[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl-[2-(2-hydroxyethoxy)ethyl]amino]-2-methylphenyl]diazenyl]-1,3-thiazol-3-ium-3-yl]acetate |
|---|---|
| PubChem CID | 87572921 |
| Molecular Formula | C22H32N4O7S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 2-[2-[[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl-[2-(2-hydroxyethoxy)ethyl]amino]-2-methylphenyl]diazenyl]-1,3-thiazol-3-ium-3-yl]acetate |
| SMILES | Cc1cc(N(CCOCCO)CCOCCOCCO)ccc1/N=N/c1scc[n+]1CC(=O)[O-] |
| InChI | InChI=1S/C22H32N4O7S/c1-18-16-19(2-3-20(18)23-24-22-26(6-15-34-22)17-21(29)30)25(4-9-31-11-7-27)5-10-32-13-14-33-12-8-28/h2-3,6,15-16,27-28H,4-5,7-14,17H2,1H3 |
| InChIKey | GVBDMAFJRDZZAW-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 140.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|