C20H33N5OS+2 — CID 23109763
2-[N-ethyl-3-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]anilino]ethyl-(2-hydroxypropyl)-dimethylazanium (PubChem CID 23109763) has the molecular formula C20H33N5OS+2 and a molecular weight of 391.59 g/mol. Its IUPAC name is 2-[N-ethyl-3-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]anilino]ethyl-(2-hydroxypropyl)-dimethylazanium.
| Compound Name | 2-[N-ethyl-3-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]anilino]ethyl-(2-hydroxypropyl)-dimethylazanium |
|---|---|
| PubChem CID | 23109763 |
| Molecular Formula | C20H33N5OS+2 |
| Molecular Weight | 391.59 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | 2-[N-ethyl-3-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]anilino]ethyl-(2-hydroxypropyl)-dimethylazanium |
| SMILES | CCN(CC[N+](C)(C)CC(C)O)c1ccc(/N=N/c2scc[n+]2C)c(C)c1 |
| InChI | InChI=1S/C20H33N5OS/c1-7-24(10-12-25(5,6)15-17(3)26)18-8-9-19(16(2)14-18)21-22-20-23(4)11-13-27-20/h8-9,11,13-14,17,26H,7,10,12,15H2,1-6H3/q+2 |
| InChIKey | OVQCGRHRJIPMCS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.59 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|