C18H20N5O2S- — CID 20846238
4-[4-[(4-cyano-3-methyl-1,2-thiazol-5-yl)diazenyl]-N-ethyl-3-methylanilino]butanoate (PubChem CID 20846238) has the molecular formula C18H20N5O2S- and a molecular weight of 370.46 g/mol. Its IUPAC name is 4-[4-[(4-cyano-3-methyl-1,2-thiazol-5-yl)diazenyl]-N-ethyl-3-methylanilino]butanoate.
| Compound Name | 4-[4-[(4-cyano-3-methyl-1,2-thiazol-5-yl)diazenyl]-N-ethyl-3-methylanilino]butanoate |
|---|---|
| PubChem CID | 20846238 |
| Molecular Formula | C18H20N5O2S- |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 4-[4-[(4-cyano-3-methyl-1,2-thiazol-5-yl)diazenyl]-N-ethyl-3-methylanilino]butanoate |
| SMILES | CCN(CCCC(=O)[O-])c1ccc(/N=N/c2snc(C)c2C#N)c(C)c1 |
| InChI | InChI=1S/C18H21N5O2S/c1-4-23(9-5-6-17(24)25)14-7-8-16(12(2)10-14)20-21-18-15(11-19)13(3)22-26-18/h7-8,10H,4-6,9H2,1-3H3,(H,24,25)/p-1/b21-20+ |
| InChIKey | QBECUUSZRULQJU-QZQOTICOSA-M |
| XLogP | 3.40 |
| TPSA | 104.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|