C21H21ClN4O4 — CID 89258111
6-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-ethyl-3-methylanilino]hex-1-ene-3,4-dione (PubChem CID 89258111) has the molecular formula C21H21ClN4O4 and a molecular weight of 428.88 g/mol. Its IUPAC name is 6-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-ethyl-3-methylanilino]hex-1-ene-3,4-dione.
| Compound Name | 6-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-ethyl-3-methylanilino]hex-1-ene-3,4-dione |
|---|---|
| PubChem CID | 89258111 |
| Molecular Formula | C21H21ClN4O4 |
| Molecular Weight | 428.88 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 6-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-ethyl-3-methylanilino]hex-1-ene-3,4-dione |
| SMILES | C=CC(=O)C(=O)CCN(CC)c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2Cl)c(C)c1 |
| InChI | InChI=1S/C21H21ClN4O4/c1-4-20(27)21(28)10-11-25(5-2)15-6-8-18(14(3)12-15)23-24-19-9-7-16(26(29)30)13-17(19)22/h4,6-9,12-13H,1,5,10-11H2,2-3H3/b24-23+ |
| InChIKey | JQQZTTHLNWSWBB-WCWDXBQESA-N |
| XLogP | 5.51 |
| TPSA | 105.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.88 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|