C24H25ClN4O8 — CID 90138075
2-oxopropyl 3-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-[3-oxo-3-(2-oxopropoxy)propyl]anilino]propanoate (PubChem CID 90138075) has the molecular formula C24H25ClN4O8 and a molecular weight of 532.94 g/mol. Its IUPAC name is 2-oxopropyl 3-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-[3-oxo-3-(2-oxopropoxy)propyl]anilino]propanoate.
| Compound Name | 2-oxopropyl 3-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-[3-oxo-3-(2-oxopropoxy)propyl]anilino]propanoate |
|---|---|
| PubChem CID | 90138075 |
| Molecular Formula | C24H25ClN4O8 |
| Molecular Weight | 532.94 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | 2-oxopropyl 3-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-[3-oxo-3-(2-oxopropoxy)propyl]anilino]propanoate |
| SMILES | CC(=O)COC(=O)CCN(CCC(=O)OCC(C)=O)c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2Cl)cc1 |
| InChI | InChI=1S/C24H25ClN4O8/c1-16(30)14-36-23(32)9-11-28(12-10-24(33)37-15-17(2)31)19-5-3-18(4-6-19)26-27-22-8-7-20(29(34)35)13-21(22)25/h3-8,13H,9-12,14-15H2,1-2H3/b27-26+ |
| InChIKey | QQWSGUJNGVEJJJ-CYYJNZCTSA-N |
| XLogP | 4.51 |
| TPSA | 157.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.94 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|