C19H19N5O4 — CID 131883039
methyl 3-[N-(2-cyanoethyl)-4-[(4-nitrophenyl)diazenyl]anilino]propanoate (PubChem CID 131883039) has the molecular formula C19H19N5O4 and a molecular weight of 381.39 g/mol. Its IUPAC name is methyl 3-[N-(2-cyanoethyl)-4-[(4-nitrophenyl)diazenyl]anilino]propanoate.
| Compound Name | methyl 3-[N-(2-cyanoethyl)-4-[(4-nitrophenyl)diazenyl]anilino]propanoate |
|---|---|
| PubChem CID | 131883039 |
| Molecular Formula | C19H19N5O4 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | methyl 3-[N-(2-cyanoethyl)-4-[(4-nitrophenyl)diazenyl]anilino]propanoate |
| SMILES | COC(=O)CCN(CCC#N)c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C19H19N5O4/c1-28-19(25)11-14-23(13-2-12-20)17-7-3-15(4-8-17)21-22-16-5-9-18(10-6-16)24(26)27/h3-10H,2,11,13-14H2,1H3/b22-21+ |
| InChIKey | UNOAKMCLFFZZOX-QURGRASLSA-N |
| XLogP | 4.29 |
| TPSA | 121.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|