C18H19N5O8S — CID 101054938
methyl 3-[4-[(3,5-dinitrothiophen-2-yl)diazenyl]-N-(3-methoxy-3-oxopropyl)anilino]propanoate (PubChem CID 101054938) has the molecular formula C18H19N5O8S and a molecular weight of 465.44 g/mol. Its IUPAC name is methyl 3-[4-[(3,5-dinitrothiophen-2-yl)diazenyl]-N-(3-methoxy-3-oxopropyl)anilino]propanoate.
| Compound Name | methyl 3-[4-[(3,5-dinitrothiophen-2-yl)diazenyl]-N-(3-methoxy-3-oxopropyl)anilino]propanoate |
|---|---|
| PubChem CID | 101054938 |
| Molecular Formula | C18H19N5O8S |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | methyl 3-[4-[(3,5-dinitrothiophen-2-yl)diazenyl]-N-(3-methoxy-3-oxopropyl)anilino]propanoate |
| SMILES | COC(=O)CCN(CCC(=O)OC)c1ccc(/N=N/c2sc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H19N5O8S/c1-30-16(24)7-9-21(10-8-17(25)31-2)13-5-3-12(4-6-13)19-20-18-14(22(26)27)11-15(32-18)23(28)29/h3-6,11H,7-10H2,1-2H3/b20-19+ |
| InChIKey | XMJBFJVUBHAHPH-FMQUCBEESA-N |
| XLogP | 3.91 |
| TPSA | 166.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|