C26H35N5O6S3 — CID 102418467
S-[6-[N-(6-acetylsulfanylhexyl)-4-[(3,5-dinitrothiophen-2-yl)diazenyl]anilino]hexyl] ethanethioate (PubChem CID 102418467) has the molecular formula C26H35N5O6S3 and a molecular weight of 609.80 g/mol. Its IUPAC name is S-[6-[N-(6-acetylsulfanylhexyl)-4-[(3,5-dinitrothiophen-2-yl)diazenyl]anilino]hexyl] ethanethioate.
| Compound Name | S-[6-[N-(6-acetylsulfanylhexyl)-4-[(3,5-dinitrothiophen-2-yl)diazenyl]anilino]hexyl] ethanethioate |
|---|---|
| PubChem CID | 102418467 |
| Molecular Formula | C26H35N5O6S3 |
| Molecular Weight | 609.80 g/mol |
| Exact Mass | 609.17 |
| IUPAC Name | S-[6-[N-(6-acetylsulfanylhexyl)-4-[(3,5-dinitrothiophen-2-yl)diazenyl]anilino]hexyl] ethanethioate |
| SMILES | CC(=O)SCCCCCCN(CCCCCCSC(C)=O)c1ccc(/N=N/c2sc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H35N5O6S3/c1-20(32)38-17-9-5-3-7-15-29(16-8-4-6-10-18-39-21(2)33)23-13-11-22(12-14-23)27-28-26-24(30(34)35)19-25(40-26)31(36)37/h11-14,19H,3-10,15-18H2,1-2H3/b28-27+ |
| InChIKey | AKQGMYAEYRSPMD-BYYHNAKLSA-N |
| XLogP | 8.47 |
| TPSA | 148.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.80 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|