C20H21N3O8S — CID 10742741
2-[N-(2-acetyloxyethyl)-4-[(E)-2-(3,5-dinitrothiophen-2-yl)ethenyl]anilino]ethyl acetate (PubChem CID 10742741) has the molecular formula C20H21N3O8S and a molecular weight of 463.47 g/mol. Its IUPAC name is 2-[N-(2-acetyloxyethyl)-4-[(E)-2-(3,5-dinitrothiophen-2-yl)ethenyl]anilino]ethyl acetate.
| Compound Name | 2-[N-(2-acetyloxyethyl)-4-[(E)-2-(3,5-dinitrothiophen-2-yl)ethenyl]anilino]ethyl acetate |
|---|---|
| PubChem CID | 10742741 |
| Molecular Formula | C20H21N3O8S |
| Molecular Weight | 463.47 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 2-[N-(2-acetyloxyethyl)-4-[(E)-2-(3,5-dinitrothiophen-2-yl)ethenyl]anilino]ethyl acetate |
| SMILES | CC(=O)OCCN(CCOC(C)=O)c1ccc(/C=C/c2sc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H21N3O8S/c1-14(24)30-11-9-21(10-12-31-15(2)25)17-6-3-16(4-7-17)5-8-19-18(22(26)27)13-20(32-19)23(28)29/h3-8,13H,9-12H2,1-2H3/b8-5+ |
| InChIKey | HRDNVIQAKNYGMO-VMPITWQZSA-N |
| XLogP | 3.67 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|